C32H32N2O3 — CID 118063356
4-methoxy-N-[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]-3-phenylbenzamide (PubChem CID 118063356) has the molecular formula C32H32N2O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is 4-methoxy-N-[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]-3-phenylbenzamide.
| Compound Name | 4-methoxy-N-[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]-3-phenylbenzamide |
|---|---|
| PubChem CID | 118063356 |
| Molecular Formula | C32H32N2O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 4-methoxy-N-[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]-3-phenylbenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(-c3ccc(OC4CCN(C)CC4)cc3)cc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C32H32N2O3/c1-34-20-18-29(19-21-34)37-28-15-10-24(11-16-28)23-8-13-27(14-9-23)33-32(35)26-12-17-31(36-2)30(22-26)25-6-4-3-5-7-25/h3-17,22,29H,18-21H2,1-2H3,(H,33,35) |
| InChIKey | FHUIFTQCAAVUNM-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |