C25H20N8O — CID 118063723
N-[2-(4-amino-3-indol-1-ylpyrazolo[3,4-d]pyrimidin-1-yl)ethyl]-2-cyano-N-phenylprop-2-enamide (PubChem CID 118063723) has the molecular formula C25H20N8O and a molecular weight of 448.49 g/mol. Its IUPAC name is N-[2-(4-amino-3-indol-1-ylpyrazolo[3,4-d]pyrimidin-1-yl)ethyl]-2-cyano-N-phenylprop-2-enamide.
| Compound Name | N-[2-(4-amino-3-indol-1-ylpyrazolo[3,4-d]pyrimidin-1-yl)ethyl]-2-cyano-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 118063723 |
| Molecular Formula | C25H20N8O |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[2-(4-amino-3-indol-1-ylpyrazolo[3,4-d]pyrimidin-1-yl)ethyl]-2-cyano-N-phenylprop-2-enamide |
| SMILES | C=C(C#N)C(=O)N(CCn1nc(-n2ccc3ccccc32)c2c(N)ncnc21)c1ccccc1 |
| InChI | InChI=1S/C25H20N8O/c1-17(15-26)25(34)31(19-8-3-2-4-9-19)13-14-33-23-21(22(27)28-16-29-23)24(30-33)32-12-11-18-7-5-6-10-20(18)32/h2-12,16H,1,13-14H2,(H2,27,28,29) |
| InChIKey | WGOMGUXGJJNMSJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|