C12H18O4 — CID 11806373
(1R,3S,8R,10S)-10-methyl-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-6-one (PubChem CID 11806373) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (1R,3S,8R,10S)-10-methyl-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-6-one.
| Compound Name | (1R,3S,8R,10S)-10-methyl-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-6-one |
|---|---|
| PubChem CID | 11806373 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (1R,3S,8R,10S)-10-methyl-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-6-one |
| SMILES | C[C@]12C[C@H]3OC(=O)CC[C@@H]3O[C@@H]1CCCO2 |
| InChI | InChI=1S/C12H18O4/c1-12-7-9-8(4-5-11(13)16-9)15-10(12)3-2-6-14-12/h8-10H,2-7H2,1H3/t8-,9+,10+,12-/m0/s1 |
| InChIKey | HXNDRLDHPHNPAX-XNDJQWLSSA-N |
| XLogP | 1.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |