C10H18N2O2 — CID 118064037
1,2-diazaspiro[5.5]undecane-9-carboxylic acid (PubChem CID 118064037) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 1,2-diazaspiro[5.5]undecane-9-carboxylic acid.
| Compound Name | 1,2-diazaspiro[5.5]undecane-9-carboxylic acid |
|---|---|
| PubChem CID | 118064037 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1,2-diazaspiro[5.5]undecane-9-carboxylic acid |
| SMILES | O=C(O)C1CCC2(CCCNN2)CC1 |
| InChI | InChI=1S/C10H18N2O2/c13-9(14)8-2-5-10(6-3-8)4-1-7-11-12-10/h8,11-12H,1-7H2,(H,13,14) |
| InChIKey | GIMSDUWHNZWLMZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |