C22H15F8N3O5 — CID 118064144
(2,3,4,5,6-pentafluorophenyl) 2-[2-[[1,1,1-trifluoro-3-[(2-methylpropan-2-yl)oxy]-3-oxopropan-2-yl]amino]-4-pyridinyl]-1,3-oxazole-4-carboxylate (PubChem CID 118064144) has the molecular formula C22H15F8N3O5 and a molecular weight of 553.36 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-[2-[[1,1,1-trifluoro-3-[(2-methylpropan-2-yl)oxy]-3-oxopropan-2-yl]amino]-4-pyridinyl]-1,3-oxazole-4-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-[2-[[1,1,1-trifluoro-3-[(2-methylpropan-2-yl)oxy]-3-oxopropan-2-yl]amino]-4-pyridinyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 118064144 |
| Molecular Formula | C22H15F8N3O5 |
| Molecular Weight | 553.36 g/mol |
| Exact Mass | 553.09 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-[2-[[1,1,1-trifluoro-3-[(2-methylpropan-2-yl)oxy]-3-oxopropan-2-yl]amino]-4-pyridinyl]-1,3-oxazole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C(Nc1cc(-c2nc(C(=O)Oc3c(F)c(F)c(F)c(F)c3F)co2)ccn1)C(F)(F)F |
| InChI | InChI=1S/C22H15F8N3O5/c1-21(2,3)38-20(35)17(22(28,29)30)33-10-6-8(4-5-31-10)18-32-9(7-36-18)19(34)37-16-14(26)12(24)11(23)13(25)15(16)27/h4-7,17H,1-3H3,(H,31,33) |
| InChIKey | JRKLQHWVWBMNTL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.36 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|