C18H18FN3O2 — CID 118064827
4-[4-(6-fluoro-1H-indol-3-yl)pyrazol-1-yl]cyclohexane-1-carboxylic acid (PubChem CID 118064827) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is 4-[4-(6-fluoro-1H-indol-3-yl)pyrazol-1-yl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-(6-fluoro-1H-indol-3-yl)pyrazol-1-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 118064827 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 4-[4-(6-fluoro-1H-indol-3-yl)pyrazol-1-yl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(n2cc(-c3c[nH]c4cc(F)ccc34)cn2)CC1 |
| InChI | InChI=1S/C18H18FN3O2/c19-13-3-6-15-16(9-20-17(15)7-13)12-8-21-22(10-12)14-4-1-11(2-5-14)18(23)24/h3,6-11,14,20H,1-2,4-5H2,(H,23,24) |
| InChIKey | SGNZLTICRMRTTE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |