C8H3ClF7NO — CID 118065026
3-chloro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1H-pyridin-2-one (PubChem CID 118065026) has the molecular formula C8H3ClF7NO and a molecular weight of 297.56 g/mol. Its IUPAC name is 3-chloro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1H-pyridin-2-one.
| Compound Name | 3-chloro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118065026 |
| Molecular Formula | C8H3ClF7NO |
| Molecular Weight | 297.56 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 3-chloro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(C(F)(C(F)(F)F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C8H3ClF7NO/c9-4-1-3(2-17-5(4)18)6(10,7(11,12)13)8(14,15)16/h1-2H,(H,17,18) |
| InChIKey | YXTGUYDNPREZFO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |