C10H21N3O3 — CID 11806511
ethyl 2-[1-(dimethylamino)propan-2-ylcarbamoylamino]acetate (PubChem CID 11806511) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is ethyl 2-[1-(dimethylamino)propan-2-ylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[1-(dimethylamino)propan-2-ylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 11806511 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | ethyl 2-[1-(dimethylamino)propan-2-ylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NC(C)CN(C)C |
| InChI | InChI=1S/C10H21N3O3/c1-5-16-9(14)6-11-10(15)12-8(2)7-13(3)4/h8H,5-7H2,1-4H3,(H2,11,12,15) |
| InChIKey | AMZZUEQLZLXCTR-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |