C11H12ClF3N2O2 — CID 118065568
6-chloro-4-[(2R,4R)-2-ethyl-4-(trifluoromethyl)-1,3-dioxolan-2-yl]pyridin-3-amine (PubChem CID 118065568) has the molecular formula C11H12ClF3N2O2 and a molecular weight of 296.68 g/mol. Its IUPAC name is 6-chloro-4-[(2R,4R)-2-ethyl-4-(trifluoromethyl)-1,3-dioxolan-2-yl]pyridin-3-amine.
| Compound Name | 6-chloro-4-[(2R,4R)-2-ethyl-4-(trifluoromethyl)-1,3-dioxolan-2-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 118065568 |
| Molecular Formula | C11H12ClF3N2O2 |
| Molecular Weight | 296.68 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 6-chloro-4-[(2R,4R)-2-ethyl-4-(trifluoromethyl)-1,3-dioxolan-2-yl]pyridin-3-amine |
| SMILES | CC[C@@]1(c2cc(Cl)ncc2N)OC[C@H](C(F)(F)F)O1 |
| InChI | InChI=1S/C11H12ClF3N2O2/c1-2-10(6-3-9(12)17-4-7(6)16)18-5-8(19-10)11(13,14)15/h3-4,8H,2,5,16H2,1H3/t8-,10-/m1/s1 |
| InChIKey | IKHCHWVZUAJOTM-PSASIEDQSA-N |
| XLogP | 2.86 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.68 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|