C9H16F5N — CID 11806562
2,2,3,3,3-pentafluoro-N,N-di(propan-2-yl)propan-1-amine (PubChem CID 11806562) has the molecular formula C9H16F5N and a molecular weight of 233.22 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N,N-di(propan-2-yl)propan-1-amine.
| Compound Name | 2,2,3,3,3-pentafluoro-N,N-di(propan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 11806562 |
| Molecular Formula | C9H16F5N |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N,N-di(propan-2-yl)propan-1-amine |
| SMILES | CC(C)N(CC(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C9H16F5N/c1-6(2)15(7(3)4)5-8(10,11)9(12,13)14/h6-7H,5H2,1-4H3 |
| InChIKey | DHPNIENWZYYEDO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|