About 2-[2-(1,3-dithian-2-yl)ethyl]-1,3-dioxane
2-[2-(1,3-dithian-2-yl)ethyl]-1,3-dioxane (PubChem CID 11806600) has the molecular formula C10H18O2S2
and a molecular weight of 234.39 g/mol. Its IUPAC name is 2-[2-(1,3-dithian-2-yl)ethyl]-1,3-dioxane.
Molecular Properties
| Compound Name | 2-[2-(1,3-dithian-2-yl)ethyl]-1,3-dioxane |
| PubChem CID | 11806600 |
| Molecular Formula | C10H18O2S2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-[2-(1,3-dithian-2-yl)ethyl]-1,3-dioxane |
| SMILES | C1COC(CCC2SCCCS2)OC1 |
| InChI | InChI=1S/C10H18O2S2/c1-5-11-9(12-6-1)3-4-10-13-7-2-8-14-10/h9-10H,1-8H2 |
| InChIKey | IORRIRMDNFTBBU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(1,3-dithian-2-yl)ethyl]-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,3-dithian-2-yl)ethyl]-1,3-dioxane?
The IUPAC name of 2-[2-(1,3-dithian-2-yl)ethyl]-1,3-dioxane (CID 11806600) is 2-[2-(1,3-dithian-2-yl)ethyl]-1,3-dioxane.
What is the SMILES notation for 2-[2-(1,3-dithian-2-yl)ethyl]-1,3-dioxane?
The canonical SMILES for 2-[2-(1,3-dithian-2-yl)ethyl]-1,3-dioxane is C1COC(CCC2SCCCS2)OC1.
What is the InChIKey of 2-[2-(1,3-dithian-2-yl)ethyl]-1,3-dioxane?
The InChIKey is IORRIRMDNFTBBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2S2/c1-5-11-9(12-6-1)3-4-10-13-7-2-8-14-10/h9-10H,1-8H2.
What are the key properties of 2-[2-(1,3-dithian-2-yl)ethyl]-1,3-dioxane?
2-[2-(1,3-dithian-2-yl)ethyl]-1,3-dioxane has a molecular weight of 234.39 g/mol, XLogP of 2.73, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3-dithian-2-yl)ethyl]-1,3-dioxane is sourced from PubChem (CID 11806600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).