C6H5F3N2O4 — CID 118066046
N-[[(4R)-2,5-dioxo-1,3-oxazolidin-4-yl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 118066046) has the molecular formula C6H5F3N2O4 and a molecular weight of 226.11 g/mol. Its IUPAC name is N-[[(4R)-2,5-dioxo-1,3-oxazolidin-4-yl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[(4R)-2,5-dioxo-1,3-oxazolidin-4-yl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 118066046 |
| Molecular Formula | C6H5F3N2O4 |
| Molecular Weight | 226.11 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | N-[[(4R)-2,5-dioxo-1,3-oxazolidin-4-yl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C1N[C@H](CNC(=O)C(F)(F)F)C(=O)O1 |
| InChI | InChI=1S/C6H5F3N2O4/c7-6(8,9)4(13)10-1-2-3(12)15-5(14)11-2/h2H,1H2,(H,10,13)(H,11,14)/t2-/m1/s1 |
| InChIKey | MDVLDSZHSCMJAA-UWTATZPHSA-N |
| XLogP | -0.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.11 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|