C25H42N8O4 — CID 118066324
1-[3-[[(2R,3S,4R,5R)-5-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea (PubChem CID 118066324) has the molecular formula C25H42N8O4 and a molecular weight of 518.66 g/mol. Its IUPAC name is 1-[3-[[(2R,3S,4R,5R)-5-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea.
| Compound Name | 1-[3-[[(2R,3S,4R,5R)-5-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea |
|---|---|
| PubChem CID | 118066324 |
| Molecular Formula | C25H42N8O4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | 1-[3-[[(2R,3S,4R,5R)-5-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]propyl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea |
| SMILES | CN(CCCNC(=O)Nc1cccc2c1CCCC2)C[C@H]1O[C@@H](N2CNC3C(N)NCNC32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H42N8O4/c1-32(11-5-10-27-25(36)31-17-9-4-7-15-6-2-3-8-16(15)17)12-18-20(34)21(35)24(37-18)33-14-30-19-22(26)28-13-29-23(19)33/h4,7,9,18-24,28-30,34-35H,2-3,5-6,8,10-14,26H2,1H3,(H2,27,31,36)/t18-,19?,20-,21-,22?,23?,24-/m1/s1 |
| InChIKey | ONVBWISWDACMMM-QAYGHVLUSA-N |
| XLogP | -1.55 |
| TPSA | 159.41 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|