About (4S)-4-methyl-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one
(4S)-4-methyl-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one (PubChem CID 11806655) has the molecular formula C6H5F6NO2
and a molecular weight of 237.10 g/mol. Its IUPAC name is (4S)-4-methyl-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one.
Molecular Properties
| Compound Name | (4S)-4-methyl-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one |
| PubChem CID | 11806655 |
| Molecular Formula | C6H5F6NO2 |
| Molecular Weight | 237.10 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | (4S)-4-methyl-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one |
| SMILES | C[C@@H]1NC(C(F)(F)F)(C(F)(F)F)OC1=O |
| InChI | InChI=1S/C6H5F6NO2/c1-2-3(14)15-4(13-2,5(7,8)9)6(10,11)12/h2,13H,1H3/t2-/m0/s1 |
| InChIKey | QGCACAZTPOOTIX-REOHCLBHSA-N |
| XLogP | 1.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.10 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-4-methyl-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-methyl-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one?
The IUPAC name of (4S)-4-methyl-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one (CID 11806655) is (4S)-4-methyl-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one.
What is the SMILES notation for (4S)-4-methyl-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one?
The canonical SMILES for (4S)-4-methyl-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one is C[C@@H]1NC(C(F)(F)F)(C(F)(F)F)OC1=O.
What is the InChIKey of (4S)-4-methyl-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one?
The InChIKey is QGCACAZTPOOTIX-REOHCLBHSA-N. The full InChI is InChI=1S/C6H5F6NO2/c1-2-3(14)15-4(13-2,5(7,8)9)6(10,11)12/h2,13H,1H3/t2-/m0/s1.
What are the key properties of (4S)-4-methyl-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one?
(4S)-4-methyl-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one has a molecular weight of 237.10 g/mol, XLogP of 1.34, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-methyl-2,2-bis(trifluoromethyl)-1,3-oxazolidin-5-one is sourced from PubChem (CID 11806655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).