C12H22F3N — CID 11806670
(E)-1,1,1-trifluoro-N,N-dimethyldec-2-en-4-amine (PubChem CID 11806670) has the molecular formula C12H22F3N and a molecular weight of 237.31 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-N,N-dimethyldec-2-en-4-amine.
| Compound Name | (E)-1,1,1-trifluoro-N,N-dimethyldec-2-en-4-amine |
|---|---|
| PubChem CID | 11806670 |
| Molecular Formula | C12H22F3N |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (E)-1,1,1-trifluoro-N,N-dimethyldec-2-en-4-amine |
| SMILES | CCCCCCC(/C=C/C(F)(F)F)N(C)C |
| InChI | InChI=1S/C12H22F3N/c1-4-5-6-7-8-11(16(2)3)9-10-12(13,14)15/h9-11H,4-8H2,1-3H3/b10-9+ |
| InChIKey | FPWVWPARBHFQGH-MDZDMXLPSA-N |
| XLogP | 4.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|