About 4-deuterio-5-hydroxycyclopent-4-ene-1,2,3-trione
4-deuterio-5-hydroxycyclopent-4-ene-1,2,3-trione (PubChem CID 118066945) has the molecular formula C5H2O4
and a molecular weight of 127.07 g/mol. Its IUPAC name is 4-deuterio-5-hydroxycyclopent-4-ene-1,2,3-trione.
Molecular Properties
| Compound Name | 4-deuterio-5-hydroxycyclopent-4-ene-1,2,3-trione |
| PubChem CID | 118066945 |
| Molecular Formula | C5H2O4 |
| Molecular Weight | 127.07 g/mol |
| Exact Mass | 127.00 |
| IUPAC Name | 4-deuterio-5-hydroxycyclopent-4-ene-1,2,3-trione |
| SMILES | [2H]c1c(O)c(=O)c(=O)c1=O |
| InChI | InChI=1S/C5H2O4/c6-2-1-3(7)5(9)4(2)8/h1,6H/i1D |
| InChIKey | WKOZEOXIHADQRE-MICDWDOJSA-N |
| XLogP | -1.65 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.07 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-deuterio-5-hydroxycyclopent-4-ene-1,2,3-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-deuterio-5-hydroxycyclopent-4-ene-1,2,3-trione?
The IUPAC name of 4-deuterio-5-hydroxycyclopent-4-ene-1,2,3-trione (CID 118066945) is 4-deuterio-5-hydroxycyclopent-4-ene-1,2,3-trione.
What is the SMILES notation for 4-deuterio-5-hydroxycyclopent-4-ene-1,2,3-trione?
The canonical SMILES for 4-deuterio-5-hydroxycyclopent-4-ene-1,2,3-trione is [2H]c1c(O)c(=O)c(=O)c1=O.
What is the InChIKey of 4-deuterio-5-hydroxycyclopent-4-ene-1,2,3-trione?
The InChIKey is WKOZEOXIHADQRE-MICDWDOJSA-N. The full InChI is InChI=1S/C5H2O4/c6-2-1-3(7)5(9)4(2)8/h1,6H/i1D.
What are the key properties of 4-deuterio-5-hydroxycyclopent-4-ene-1,2,3-trione?
4-deuterio-5-hydroxycyclopent-4-ene-1,2,3-trione has a molecular weight of 127.07 g/mol, XLogP of -1.65, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-deuterio-5-hydroxycyclopent-4-ene-1,2,3-trione is sourced from PubChem (CID 118066945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).