C31H38F4O3S — CID 118067045
(2,4,6-tricyclohexylphenyl) 2,3,5,6-tetrafluoro-4-methylbenzenesulfonate (PubChem CID 118067045) has the molecular formula C31H38F4O3S and a molecular weight of 566.70 g/mol. Its IUPAC name is (2,4,6-tricyclohexylphenyl) 2,3,5,6-tetrafluoro-4-methylbenzenesulfonate.
| Compound Name | (2,4,6-tricyclohexylphenyl) 2,3,5,6-tetrafluoro-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 118067045 |
| Molecular Formula | C31H38F4O3S |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | (2,4,6-tricyclohexylphenyl) 2,3,5,6-tetrafluoro-4-methylbenzenesulfonate |
| SMILES | Cc1c(F)c(F)c(S(=O)(=O)Oc2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C31H38F4O3S/c1-19-26(32)28(34)31(29(35)27(19)33)39(36,37)38-30-24(21-13-7-3-8-14-21)17-23(20-11-5-2-6-12-20)18-25(30)22-15-9-4-10-16-22/h17-18,20-22H,2-16H2,1H3 |
| InChIKey | FARHQYJHZYZIOM-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|