C28H30FN7O2 — CID 118067205
N-[3-[[2-[3-fluoro-4-(4-propylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide (PubChem CID 118067205) has the molecular formula C28H30FN7O2 and a molecular weight of 515.59 g/mol. Its IUPAC name is N-[3-[[2-[3-fluoro-4-(4-propylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[3-fluoro-4-(4-propylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118067205 |
| Molecular Formula | C28H30FN7O2 |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | N-[3-[[2-[3-fluoro-4-(4-propylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(CCC)CC4)c(F)c3)nc3[nH]ccc23)c1 |
| InChI | InChI=1S/C28H30FN7O2/c1-3-12-35-13-15-36(16-14-35)24-9-8-20(18-23(24)29)32-28-33-26-22(10-11-30-26)27(34-28)38-21-7-5-6-19(17-21)31-25(37)4-2/h4-11,17-18H,2-3,12-16H2,1H3,(H,31,37)(H2,30,32,33,34) |
| InChIKey | XCZOVLROCQGVJH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|