C34H40FN7O4 — CID 118067206
[2-[3-fluoro-4-(4-propylpiperazin-1-yl)anilino]-4-[3-(prop-2-enoylamino)phenoxy]pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate (PubChem CID 118067206) has the molecular formula C34H40FN7O4 and a molecular weight of 629.74 g/mol. Its IUPAC name is [2-[3-fluoro-4-(4-propylpiperazin-1-yl)anilino]-4-[3-(prop-2-enoylamino)phenoxy]pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [2-[3-fluoro-4-(4-propylpiperazin-1-yl)anilino]-4-[3-(prop-2-enoylamino)phenoxy]pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118067206 |
| Molecular Formula | C34H40FN7O4 |
| Molecular Weight | 629.74 g/mol |
| Exact Mass | 629.31 |
| IUPAC Name | [2-[3-fluoro-4-(4-propylpiperazin-1-yl)anilino]-4-[3-(prop-2-enoylamino)phenoxy]pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(CCC)CC4)c(F)c3)nc3c2ccn3COC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C34H40FN7O4/c1-6-14-40-16-18-41(19-17-40)28-12-11-24(21-27(28)35)37-33-38-30-26(13-15-42(30)22-45-32(44)34(3,4)5)31(39-33)46-25-10-8-9-23(20-25)36-29(43)7-2/h7-13,15,20-21H,2,6,14,16-19,22H2,1,3-5H3,(H,36,43)(H,37,38,39) |
| InChIKey | IWHBDOKURLEDEE-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.74 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|