C32H39N7O5 — CID 118067207
[2-[4-[methyl-[(3S)-1-propylpyrrolidin-3-yl]amino]anilino]-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate (PubChem CID 118067207) has the molecular formula C32H39N7O5 and a molecular weight of 601.71 g/mol. Its IUPAC name is [2-[4-[methyl-[(3S)-1-propylpyrrolidin-3-yl]amino]anilino]-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [2-[4-[methyl-[(3S)-1-propylpyrrolidin-3-yl]amino]anilino]-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118067207 |
| Molecular Formula | C32H39N7O5 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | [2-[4-[methyl-[(3S)-1-propylpyrrolidin-3-yl]amino]anilino]-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CCCN1CC[C@H](N(C)c2ccc(Nc3nc(Oc4cccc([N+](=O)[O-])c4)c4ccn(COC(=O)C(C)(C)C)c4n3)cc2)C1 |
| InChI | InChI=1S/C32H39N7O5/c1-6-16-37-17-14-25(20-37)36(5)23-12-10-22(11-13-23)33-31-34-28-27(15-18-38(28)21-43-30(40)32(2,3)4)29(35-31)44-26-9-7-8-24(19-26)39(41)42/h7-13,15,18-19,25H,6,14,16-17,20-21H2,1-5H3,(H,33,34,35)/t25-/m0/s1 |
| InChIKey | OAKMBDKWYTWDSG-VWLOTQADSA-N |
| XLogP | 6.34 |
| TPSA | 127.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|