C25H27N5O3 — CID 118067211
N-[3-[5-methoxy-2-[(2-propyl-1,3-dihydroisoindol-5-yl)amino]pyrimidin-4-yl]oxyphenyl]prop-2-enamide (PubChem CID 118067211) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[3-[5-methoxy-2-[(2-propyl-1,3-dihydroisoindol-5-yl)amino]pyrimidin-4-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[5-methoxy-2-[(2-propyl-1,3-dihydroisoindol-5-yl)amino]pyrimidin-4-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118067211 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-[3-[5-methoxy-2-[(2-propyl-1,3-dihydroisoindol-5-yl)amino]pyrimidin-4-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc4c(c3)CN(CCC)C4)ncc2OC)c1 |
| InChI | InChI=1S/C25H27N5O3/c1-4-11-30-15-17-9-10-20(12-18(17)16-30)28-25-26-14-22(32-3)24(29-25)33-21-8-6-7-19(13-21)27-23(31)5-2/h5-10,12-14H,2,4,11,15-16H2,1,3H3,(H,27,31)(H,26,28,29) |
| InChIKey | WGBQNSXDHZBZTC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|