C14H14F3NO2 — CID 118067464
(2E,5Z)-5-ethenyl-4-prop-1-en-2-ylimino-6-(trifluoromethyl)octa-2,5,7-trienoic acid (PubChem CID 118067464) has the molecular formula C14H14F3NO2 and a molecular weight of 285.27 g/mol. Its IUPAC name is (2E,5Z)-5-ethenyl-4-prop-1-en-2-ylimino-6-(trifluoromethyl)octa-2,5,7-trienoic acid.
| Compound Name | (2E,5Z)-5-ethenyl-4-prop-1-en-2-ylimino-6-(trifluoromethyl)octa-2,5,7-trienoic acid |
|---|---|
| PubChem CID | 118067464 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (2E,5Z)-5-ethenyl-4-prop-1-en-2-ylimino-6-(trifluoromethyl)octa-2,5,7-trienoic acid |
| SMILES | C=CC(=C(\C=C)C(F)(F)F)/C(/C=C/C(=O)O)=N/C(=C)C |
| InChI | InChI=1S/C14H14F3NO2/c1-5-10(11(6-2)14(15,16)17)12(18-9(3)4)7-8-13(19)20/h5-8H,1-3H2,4H3,(H,19,20)/b8-7+,11-10-,18-12+ |
| InChIKey | GGIOHZGSONXYJL-MHAZSDRLSA-N |
| XLogP | 3.83 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|