About [(E)-1,2-dimethoxy-2-phenylethenyl]benzene
[(E)-1,2-dimethoxy-2-phenylethenyl]benzene (PubChem CID 11806751) has the molecular formula C16H16O2
and a molecular weight of 240.30 g/mol. Its IUPAC name is [(E)-1,2-dimethoxy-2-phenylethenyl]benzene.
Molecular Properties
| Compound Name | [(E)-1,2-dimethoxy-2-phenylethenyl]benzene |
| PubChem CID | 11806751 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | [(E)-1,2-dimethoxy-2-phenylethenyl]benzene |
| SMILES | CO/C(=C(/OC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16O2/c1-17-15(13-9-5-3-6-10-13)16(18-2)14-11-7-4-8-12-14/h3-12H,1-2H3/b16-15+ |
| InChIKey | ZOZOROJQSSXZSU-FOCLMDBBSA-N |
| XLogP | 3.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1,2-dimethoxy-2-phenylethenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1,2-dimethoxy-2-phenylethenyl]benzene?
The IUPAC name of [(E)-1,2-dimethoxy-2-phenylethenyl]benzene (CID 11806751) is [(E)-1,2-dimethoxy-2-phenylethenyl]benzene.
What is the SMILES notation for [(E)-1,2-dimethoxy-2-phenylethenyl]benzene?
The canonical SMILES for [(E)-1,2-dimethoxy-2-phenylethenyl]benzene is CO/C(=C(/OC)c1ccccc1)c1ccccc1.
What is the InChIKey of [(E)-1,2-dimethoxy-2-phenylethenyl]benzene?
The InChIKey is ZOZOROJQSSXZSU-FOCLMDBBSA-N. The full InChI is InChI=1S/C16H16O2/c1-17-15(13-9-5-3-6-10-13)16(18-2)14-11-7-4-8-12-14/h3-12H,1-2H3/b16-15+.
What are the key properties of [(E)-1,2-dimethoxy-2-phenylethenyl]benzene?
[(E)-1,2-dimethoxy-2-phenylethenyl]benzene has a molecular weight of 240.30 g/mol, XLogP of 3.81, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1,2-dimethoxy-2-phenylethenyl]benzene is sourced from PubChem (CID 11806751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).