C16H16O2 — CID 11806752
(4aZ)-9-hydroxy-10,10-dimethyl-6,7,11,12-tetradehydro-2,3,4,9-tetrahydrobenzo[10]annulen-8-one (PubChem CID 11806752) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is (4aZ)-9-hydroxy-10,10-dimethyl-6,7,11,12-tetradehydro-2,3,4,9-tetrahydrobenzo[10]annulen-8-one.
| Compound Name | (4aZ)-9-hydroxy-10,10-dimethyl-6,7,11,12-tetradehydro-2,3,4,9-tetrahydrobenzo[10]annulen-8-one |
|---|---|
| PubChem CID | 11806752 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (4aZ)-9-hydroxy-10,10-dimethyl-6,7,11,12-tetradehydro-2,3,4,9-tetrahydrobenzo[10]annulen-8-one |
| SMILES | CC1(C)C#CC2=CCCC/C2=C/C#CC(=O)C1O |
| InChI | InChI=1S/C16H16O2/c1-16(2)11-10-13-7-4-3-6-12(13)8-5-9-14(17)15(16)18/h7-8,15,18H,3-4,6H2,1-2H3/b12-8- |
| InChIKey | BOMJQGWFHGBRGO-WQLSENKSSA-N |
| XLogP | 2.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|