About [3-fluoro-4-(3-fluoro-4,5-dimethylphenyl)-5-methylphenyl] hypofluorite
[3-fluoro-4-(3-fluoro-4,5-dimethylphenyl)-5-methylphenyl] hypofluorite (PubChem CID 118067721) has the molecular formula C15H13F3O
and a molecular weight of 266.26 g/mol. Its IUPAC name is [3-fluoro-4-(3-fluoro-4,5-dimethylphenyl)-5-methylphenyl] hypofluorite.
Molecular Properties
| Compound Name | [3-fluoro-4-(3-fluoro-4,5-dimethylphenyl)-5-methylphenyl] hypofluorite |
| PubChem CID | 118067721 |
| Molecular Formula | C15H13F3O |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | [3-fluoro-4-(3-fluoro-4,5-dimethylphenyl)-5-methylphenyl] hypofluorite |
| SMILES | Cc1cc(-c2c(C)cc(OF)cc2F)cc(F)c1C |
| InChI | InChI=1S/C15H13F3O/c1-8-4-11(6-13(16)10(8)3)15-9(2)5-12(19-18)7-14(15)17/h4-7H,1-3H3 |
| InChIKey | VPJDLQFZZLHULD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [3-fluoro-4-(3-fluoro-4,5-dimethylphenyl)-5-methylphenyl] hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-4-(3-fluoro-4,5-dimethylphenyl)-5-methylphenyl] hypofluorite?
The IUPAC name of [3-fluoro-4-(3-fluoro-4,5-dimethylphenyl)-5-methylphenyl] hypofluorite (CID 118067721) is [3-fluoro-4-(3-fluoro-4,5-dimethylphenyl)-5-methylphenyl] hypofluorite.
What is the SMILES notation for [3-fluoro-4-(3-fluoro-4,5-dimethylphenyl)-5-methylphenyl] hypofluorite?
The canonical SMILES for [3-fluoro-4-(3-fluoro-4,5-dimethylphenyl)-5-methylphenyl] hypofluorite is Cc1cc(-c2c(C)cc(OF)cc2F)cc(F)c1C.
What is the InChIKey of [3-fluoro-4-(3-fluoro-4,5-dimethylphenyl)-5-methylphenyl] hypofluorite?
The InChIKey is VPJDLQFZZLHULD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3O/c1-8-4-11(6-13(16)10(8)3)15-9(2)5-12(19-18)7-14(15)17/h4-7H,1-3H3.
What are the key properties of [3-fluoro-4-(3-fluoro-4,5-dimethylphenyl)-5-methylphenyl] hypofluorite?
[3-fluoro-4-(3-fluoro-4,5-dimethylphenyl)-5-methylphenyl] hypofluorite has a molecular weight of 266.26 g/mol, XLogP of 4.82, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-4-(3-fluoro-4,5-dimethylphenyl)-5-methylphenyl] hypofluorite is sourced from PubChem (CID 118067721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).