C20H24BrNO5 — CID 118067930
ethyl (4R,4aR,6R,7aR,12bS)-11-bromo-6,7-dihydroxy-9-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate (PubChem CID 118067930) has the molecular formula C20H24BrNO5 and a molecular weight of 438.32 g/mol. Its IUPAC name is ethyl (4R,4aR,6R,7aR,12bS)-11-bromo-6,7-dihydroxy-9-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate.
| Compound Name | ethyl (4R,4aR,6R,7aR,12bS)-11-bromo-6,7-dihydroxy-9-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 118067930 |
| Molecular Formula | C20H24BrNO5 |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | ethyl (4R,4aR,6R,7aR,12bS)-11-bromo-6,7-dihydroxy-9-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-carboxylate |
| SMILES | CCOC(=O)N1CC[C@]23c4c5c(Br)cc(C)c4O[C@H]2C(O)[C@H](O)C[C@H]3[C@H]1C5 |
| InChI | InChI=1S/C20H24BrNO5/c1-3-26-19(25)22-5-4-20-11-8-14(23)16(24)18(20)27-17-9(2)6-12(21)10(15(17)20)7-13(11)22/h6,11,13-14,16,18,23-24H,3-5,7-8H2,1-2H3/t11-,13+,14+,16?,18-,20-/m0/s1 |
| InChIKey | KJAUPYRPDADMOE-UIYJOQHVSA-N |
| XLogP | 2.28 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |