C12H20O5 — CID 11806862
[(2R,3R)-3-[5-(2-methoxyethoxymethoxy)pent-3-ynyl]oxiran-2-yl]methanol (PubChem CID 11806862) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is [(2R,3R)-3-[5-(2-methoxyethoxymethoxy)pent-3-ynyl]oxiran-2-yl]methanol.
| Compound Name | [(2R,3R)-3-[5-(2-methoxyethoxymethoxy)pent-3-ynyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 11806862 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | [(2R,3R)-3-[5-(2-methoxyethoxymethoxy)pent-3-ynyl]oxiran-2-yl]methanol |
| SMILES | COCCOCOCC#CCC[C@H]1O[C@@H]1CO |
| InChI | InChI=1S/C12H20O5/c1-14-7-8-16-10-15-6-4-2-3-5-11-12(9-13)17-11/h11-13H,3,5-10H2,1H3/t11-,12-/m1/s1 |
| InChIKey | JFYKMTGQGIDROL-VXGBXAGGSA-N |
| XLogP | 0.17 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|