C12H16F2O6S — CID 118068778
(1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2,2-difluoropropanoate (PubChem CID 118068778) has the molecular formula C12H16F2O6S and a molecular weight of 326.32 g/mol. Its IUPAC name is (1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2,2-difluoropropanoate.
| Compound Name | (1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2,2-difluoropropanoate |
|---|---|
| PubChem CID | 118068778 |
| Molecular Formula | C12H16F2O6S |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | (1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2,2-difluoropropanoate |
| SMILES | CC1C2(C)OC3C(C2OC(=O)C(C)(F)F)S(=O)(=O)OC31C |
| InChI | InChI=1S/C12H16F2O6S/c1-5-10(2)7(18-9(15)12(4,13)14)6-8(19-10)11(5,3)20-21(6,16)17/h5-8H,1-4H3 |
| InChIKey | LATCMFLEZYMHRE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|