C18H17FN4O4 — CID 118068864
N-[7-[(2S,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]benzamide (PubChem CID 118068864) has the molecular formula C18H17FN4O4 and a molecular weight of 372.36 g/mol. Its IUPAC name is N-[7-[(2S,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]benzamide.
| Compound Name | N-[7-[(2S,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]benzamide |
|---|---|
| PubChem CID | 118068864 |
| Molecular Formula | C18H17FN4O4 |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-[7-[(2S,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]benzamide |
| SMILES | O=C(Nc1ncnn2c([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3F)ccc12)c1ccccc1 |
| InChI | InChI=1S/C18H17FN4O4/c19-14-15(25)13(8-24)27-16(14)11-6-7-12-17(20-9-21-23(11)12)22-18(26)10-4-2-1-3-5-10/h1-7,9,13-16,24-25H,8H2,(H,20,21,22,26)/t13-,14-,15-,16+/m1/s1 |
| InChIKey | LOLBKUZBDCACDE-FPCVCCKLSA-N |
| XLogP | 1.11 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |