C13H16FN4O12P3 — CID 118068885
[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethynyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 118068885) has the molecular formula C13H16FN4O12P3 and a molecular weight of 532.21 g/mol. Its IUPAC name is [[(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethynyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethynyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118068885 |
| Molecular Formula | C13H16FN4O12P3 |
| Molecular Weight | 532.21 g/mol |
| Exact Mass | 532.00 |
| IUPAC Name | [[(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethynyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#C[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](c2ccc3c(N)ncnn23)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C13H16FN4O12P3/c1-2-13(5-27-32(23,24)30-33(25,26)29-31(20,21)22)11(19)9(14)10(28-13)7-3-4-8-12(15)16-6-17-18(7)8/h1,3-4,6,9-11,19H,5H2,(H,23,24)(H,25,26)(H2,15,16,17)(H2,20,21,22)/t9-,10-,11-,13+/m0/s1 |
| InChIKey | BETWKMRUTKBISL-MRBYEJRBSA-N |
| XLogP | -0.20 |
| TPSA | 245.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.21 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|