C11H13N7O4 — CID 118068886
(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azido-2-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 118068886) has the molecular formula C11H13N7O4 and a molecular weight of 307.27 g/mol. Its IUPAC name is (2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azido-2-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azido-2-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 118068886 |
| Molecular Formula | C11H13N7O4 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azido-2-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | [N-]=[N+]=N[C@]1(CO)O[C@@H](c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H13N7O4/c12-10-6-2-1-5(18(6)15-4-14-10)8-7(20)9(21)11(3-19,22-8)16-17-13/h1-2,4,7-9,19-21H,3H2,(H2,12,14,15)/t7-,8-,9-,11+/m0/s1 |
| InChIKey | XBDAVQHHBSDBGF-FTYOSLGDSA-N |
| XLogP | -0.90 |
| TPSA | 174.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|