C13H15FN4O3 — CID 118068894
(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethenyl-4-fluoro-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 118068894) has the molecular formula C13H15FN4O3 and a molecular weight of 294.29 g/mol. Its IUPAC name is (2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethenyl-4-fluoro-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethenyl-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 118068894 |
| Molecular Formula | C13H15FN4O3 |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethenyl-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | C=C[C@]1(CO)O[C@@H](c2ccc3c(N)ncnn23)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C13H15FN4O3/c1-2-13(5-19)11(20)9(14)10(21-13)7-3-4-8-12(15)16-6-17-18(7)8/h2-4,6,9-11,19-20H,1,5H2,(H2,15,16,17)/t9-,10-,11-,13+/m0/s1 |
| InChIKey | XBEJZEKTUFATBB-MRBYEJRBSA-N |
| XLogP | -0.00 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|