C18H25N3O3 — CID 118068927
7-[(3aS,6S,6aS)-4,4-diethyl-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]-4-methylpyrrolo[2,1-f][1,2,4]triazine (PubChem CID 118068927) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 7-[(3aS,6S,6aS)-4,4-diethyl-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]-4-methylpyrrolo[2,1-f][1,2,4]triazine.
| Compound Name | 7-[(3aS,6S,6aS)-4,4-diethyl-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]-4-methylpyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 118068927 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 7-[(3aS,6S,6aS)-4,4-diethyl-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]-4-methylpyrrolo[2,1-f][1,2,4]triazine |
| SMILES | CCC1(CC)O[C@@H](c2ccc3c(C)ncnn23)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C18H25N3O3/c1-6-18(7-2)16-15(22-17(4,5)24-16)14(23-18)13-9-8-12-11(3)19-10-20-21(12)13/h8-10,14-16H,6-7H2,1-5H3/t14-,15-,16-/m0/s1 |
| InChIKey | ANQOVTLQDDLUCW-JYJNAYRXSA-N |
| XLogP | 3.19 |
| TPSA | 57.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |