About 2,2-dicyclopropylethyl-dimethyl-phenylsilane
2,2-dicyclopropylethyl-dimethyl-phenylsilane (PubChem CID 11806894) has the molecular formula C16H24Si
and a molecular weight of 244.45 g/mol. Its IUPAC name is 2,2-dicyclopropylethyl-dimethyl-phenylsilane.
Molecular Properties
| Compound Name | 2,2-dicyclopropylethyl-dimethyl-phenylsilane |
| PubChem CID | 11806894 |
| Molecular Formula | C16H24Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 2,2-dicyclopropylethyl-dimethyl-phenylsilane |
| SMILES | C[Si](C)(CC(C1CC1)C1CC1)c1ccccc1 |
| InChI | InChI=1S/C16H24Si/c1-17(2,15-6-4-3-5-7-15)12-16(13-8-9-13)14-10-11-14/h3-7,13-14,16H,8-12H2,1-2H3 |
| InChIKey | CEWBNRRTYXPIJQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dicyclopropylethyl-dimethyl-phenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dicyclopropylethyl-dimethyl-phenylsilane?
The IUPAC name of 2,2-dicyclopropylethyl-dimethyl-phenylsilane (CID 11806894) is 2,2-dicyclopropylethyl-dimethyl-phenylsilane.
What is the SMILES notation for 2,2-dicyclopropylethyl-dimethyl-phenylsilane?
The canonical SMILES for 2,2-dicyclopropylethyl-dimethyl-phenylsilane is C[Si](C)(CC(C1CC1)C1CC1)c1ccccc1.
What is the InChIKey of 2,2-dicyclopropylethyl-dimethyl-phenylsilane?
The InChIKey is CEWBNRRTYXPIJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24Si/c1-17(2,15-6-4-3-5-7-15)12-16(13-8-9-13)14-10-11-14/h3-7,13-14,16H,8-12H2,1-2H3.
What are the key properties of 2,2-dicyclopropylethyl-dimethyl-phenylsilane?
2,2-dicyclopropylethyl-dimethyl-phenylsilane has a molecular weight of 244.45 g/mol, XLogP of 4.04, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dicyclopropylethyl-dimethyl-phenylsilane is sourced from PubChem (CID 11806894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).