C28H35FN5O7P — CID 118068957
2-ethylbutyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 118068957) has the molecular formula C28H35FN5O7P and a molecular weight of 603.59 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118068957 |
| Molecular Formula | C28H35FN5O7P |
| Molecular Weight | 603.59 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-2-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(CC)COC(=O)[C@H](C)NP(=O)(OC[C@@]1(C#N)O[C@@H](c2ccc3c(N)ccnn23)[C@H](F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C28H35FN5O7P/c1-4-19(5-2)15-38-27(36)18(3)33-42(37,41-20-9-7-6-8-10-20)39-17-28(16-30)26(35)24(29)25(40-28)23-12-11-22-21(31)13-14-32-34(22)23/h6-14,18-19,24-26,35H,4-5,15,17,31H2,1-3H3,(H,33,37)/t18-,24-,25-,26-,28+,42?/m0/s1 |
| InChIKey | MFVIMSHLMZOSMT-NTWOWROKSA-N |
| XLogP | 4.11 |
| TPSA | 170.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|