C22H15F3N4O5S — CID 118069654
2-(3-methyl-2-oxo-1,3-benzothiazol-6-yl)-3,5-dioxo-4-[(1R)-4-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]-1,2,4-triazine-6-carboxylic acid (PubChem CID 118069654) has the molecular formula C22H15F3N4O5S and a molecular weight of 504.45 g/mol. Its IUPAC name is 2-(3-methyl-2-oxo-1,3-benzothiazol-6-yl)-3,5-dioxo-4-[(1R)-4-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]-1,2,4-triazine-6-carboxylic acid.
| Compound Name | 2-(3-methyl-2-oxo-1,3-benzothiazol-6-yl)-3,5-dioxo-4-[(1R)-4-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]-1,2,4-triazine-6-carboxylic acid |
|---|---|
| PubChem CID | 118069654 |
| Molecular Formula | C22H15F3N4O5S |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | 2-(3-methyl-2-oxo-1,3-benzothiazol-6-yl)-3,5-dioxo-4-[(1R)-4-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]-1,2,4-triazine-6-carboxylic acid |
| SMILES | Cn1c(=O)sc2cc(-n3nc(C(=O)O)c(=O)n([C@@H]4CCc5c4cccc5C(F)(F)F)c3=O)ccc21 |
| InChI | InChI=1S/C22H15F3N4O5S/c1-27-15-7-5-10(9-16(15)35-21(27)34)29-20(33)28(18(30)17(26-29)19(31)32)14-8-6-11-12(14)3-2-4-13(11)22(23,24)25/h2-5,7,9,14H,6,8H2,1H3,(H,31,32)/t14-/m1/s1 |
| InChIKey | XBPGSMZLSBGCPM-CQSZACIVSA-N |
| XLogP | 2.56 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |