C30H36F4O6S2 — CID 118069746
2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)sulfonylbenzenesulfonic acid (PubChem CID 118069746) has the molecular formula C30H36F4O6S2 and a molecular weight of 632.74 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)sulfonylbenzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)sulfonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 118069746 |
| Molecular Formula | C30H36F4O6S2 |
| Molecular Weight | 632.74 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)sulfonylbenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1c(F)c(F)c(S(=O)(=O)Oc2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C30H36F4O6S2/c31-24-26(33)30(27(34)25(32)29(24)41(35,36)37)42(38,39)40-28-22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)17-23(28)20-14-8-3-9-15-20/h16-20H,1-15H2,(H,35,36,37) |
| InChIKey | ITNICXBDKCLDMH-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.74 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|