C9H11F2NO — CID 118070158
(3aR,6aR)-4,4-difluoro-3-methyl-3a,4a,5,5a,6,6a-hexahydrocyclopropa[f][1,2]benzoxazole (PubChem CID 118070158) has the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. Its IUPAC name is (3aR,6aR)-4,4-difluoro-3-methyl-3a,4a,5,5a,6,6a-hexahydrocyclopropa[f][1,2]benzoxazole.
| Compound Name | (3aR,6aR)-4,4-difluoro-3-methyl-3a,4a,5,5a,6,6a-hexahydrocyclopropa[f][1,2]benzoxazole |
|---|---|
| PubChem CID | 118070158 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (3aR,6aR)-4,4-difluoro-3-methyl-3a,4a,5,5a,6,6a-hexahydrocyclopropa[f][1,2]benzoxazole |
| SMILES | CC1=NO[C@@H]2CC3CC3C(F)(F)[C@H]12 |
| InChI | InChI=1S/C9H11F2NO/c1-4-8-7(13-12-4)3-5-2-6(5)9(8,10)11/h5-8H,2-3H2,1H3/t5?,6?,7-,8-/m1/s1 |
| InChIKey | OSAAMYBRGXQDFW-DWYQZRHDSA-N |
| XLogP | 2.05 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |