C16H26O2 — CID 11807092
(1S,5S,7S,8S,11R)-7-(methoxymethyl)-3,3,11-trimethyltricyclo[6.3.0.01,5]undecan-4-one (PubChem CID 11807092) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (1S,5S,7S,8S,11R)-7-(methoxymethyl)-3,3,11-trimethyltricyclo[6.3.0.01,5]undecan-4-one.
| Compound Name | (1S,5S,7S,8S,11R)-7-(methoxymethyl)-3,3,11-trimethyltricyclo[6.3.0.01,5]undecan-4-one |
|---|---|
| PubChem CID | 11807092 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (1S,5S,7S,8S,11R)-7-(methoxymethyl)-3,3,11-trimethyltricyclo[6.3.0.01,5]undecan-4-one |
| SMILES | COC[C@H]1C[C@@H]2C(=O)C(C)(C)C[C@@]23[C@H](C)CC[C@@H]13 |
| InChI | InChI=1S/C16H26O2/c1-10-5-6-12-11(8-18-4)7-13-14(17)15(2,3)9-16(10,12)13/h10-13H,5-9H2,1-4H3/t10-,11-,12+,13-,16+/m1/s1 |
| InChIKey | QWYLHICKYJTKQT-VBTGVMJWSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |