C16H10F6O2 — CID 118071467
3-[3,5-bis(trifluoromethyl)phenyl]-4-methoxybenzaldehyde (PubChem CID 118071467) has the molecular formula C16H10F6O2 and a molecular weight of 348.24 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-4-methoxybenzaldehyde.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 118071467 |
| Molecular Formula | C16H10F6O2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-4-methoxybenzaldehyde |
| SMILES | COc1ccc(C=O)cc1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H10F6O2/c1-24-14-3-2-9(8-23)4-13(14)10-5-11(15(17,18)19)7-12(6-10)16(20,21)22/h2-8H,1H3 |
| InChIKey | GMUXIFKUCFGQIY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|