C9H8Cl3NO — CID 11807168
(Z)-2,2,2-trichloro-N-phenylmethoxyethanimine (PubChem CID 11807168) has the molecular formula C9H8Cl3NO and a molecular weight of 252.53 g/mol. Its IUPAC name is (Z)-2,2,2-trichloro-N-phenylmethoxyethanimine.
| Compound Name | (Z)-2,2,2-trichloro-N-phenylmethoxyethanimine |
|---|---|
| PubChem CID | 11807168 |
| Molecular Formula | C9H8Cl3NO |
| Molecular Weight | 252.53 g/mol |
| Exact Mass | 250.97 |
| IUPAC Name | (Z)-2,2,2-trichloro-N-phenylmethoxyethanimine |
| SMILES | ClC(Cl)(Cl)/C=N\OCc1ccccc1 |
| InChI | InChI=1S/C9H8Cl3NO/c10-9(11,12)7-13-14-6-8-4-2-1-3-5-8/h1-5,7H,6H2/b13-7- |
| InChIKey | SSQSEUNQXGENQT-QPEQYQDCSA-N |
| XLogP | 3.56 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|