About 2-cyclohexyl-1,1,3,3-tetraethylguanidine
2-cyclohexyl-1,1,3,3-tetraethylguanidine (PubChem CID 11807199) has the molecular formula C15H31N3
and a molecular weight of 253.43 g/mol. Its IUPAC name is 2-cyclohexyl-1,1,3,3-tetraethylguanidine.
Molecular Properties
| Compound Name | 2-cyclohexyl-1,1,3,3-tetraethylguanidine |
| PubChem CID | 11807199 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | 2-cyclohexyl-1,1,3,3-tetraethylguanidine |
| SMILES | CCN(CC)C(=NC1CCCCC1)N(CC)CC |
| InChI | InChI=1S/C15H31N3/c1-5-17(6-2)15(18(7-3)8-4)16-14-12-10-9-11-13-14/h14H,5-13H2,1-4H3 |
| InChIKey | WXIMFRYSIKGKGD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-1,1,3,3-tetraethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-1,1,3,3-tetraethylguanidine?
The IUPAC name of 2-cyclohexyl-1,1,3,3-tetraethylguanidine (CID 11807199) is 2-cyclohexyl-1,1,3,3-tetraethylguanidine.
What is the SMILES notation for 2-cyclohexyl-1,1,3,3-tetraethylguanidine?
The canonical SMILES for 2-cyclohexyl-1,1,3,3-tetraethylguanidine is CCN(CC)C(=NC1CCCCC1)N(CC)CC.
What is the InChIKey of 2-cyclohexyl-1,1,3,3-tetraethylguanidine?
The InChIKey is WXIMFRYSIKGKGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N3/c1-5-17(6-2)15(18(7-3)8-4)16-14-12-10-9-11-13-14/h14H,5-13H2,1-4H3.
What are the key properties of 2-cyclohexyl-1,1,3,3-tetraethylguanidine?
2-cyclohexyl-1,1,3,3-tetraethylguanidine has a molecular weight of 253.43 g/mol, XLogP of 3.36, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-1,1,3,3-tetraethylguanidine is sourced from PubChem (CID 11807199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).