C21H37NO — CID 118072464
2-(2-ethylphenyl)-N-(2,4,6-trimethylheptan-4-yloxy)propan-2-amine (PubChem CID 118072464) has the molecular formula C21H37NO and a molecular weight of 319.53 g/mol. Its IUPAC name is 2-(2-ethylphenyl)-N-(2,4,6-trimethylheptan-4-yloxy)propan-2-amine.
| Compound Name | 2-(2-ethylphenyl)-N-(2,4,6-trimethylheptan-4-yloxy)propan-2-amine |
|---|---|
| PubChem CID | 118072464 |
| Molecular Formula | C21H37NO |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.29 |
| IUPAC Name | 2-(2-ethylphenyl)-N-(2,4,6-trimethylheptan-4-yloxy)propan-2-amine |
| SMILES | CCc1ccccc1C(C)(C)NOC(C)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C21H37NO/c1-9-18-12-10-11-13-19(18)20(6,7)22-23-21(8,14-16(2)3)15-17(4)5/h10-13,16-17,22H,9,14-15H2,1-8H3 |
| InChIKey | LAQYRWQAHDZEJD-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|