C21H35NO2 — CID 118072888
2-(4-ethyl-3,5-dipropylphenyl)-3,5,5-trimethylmorpholin-2-ol (PubChem CID 118072888) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is 2-(4-ethyl-3,5-dipropylphenyl)-3,5,5-trimethylmorpholin-2-ol.
| Compound Name | 2-(4-ethyl-3,5-dipropylphenyl)-3,5,5-trimethylmorpholin-2-ol |
|---|---|
| PubChem CID | 118072888 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | 2-(4-ethyl-3,5-dipropylphenyl)-3,5,5-trimethylmorpholin-2-ol |
| SMILES | CCCc1cc(C2(O)OCC(C)(C)NC2C)cc(CCC)c1CC |
| InChI | InChI=1S/C21H35NO2/c1-7-10-16-12-18(13-17(11-8-2)19(16)9-3)21(23)15(4)22-20(5,6)14-24-21/h12-13,15,22-23H,7-11,14H2,1-6H3 |
| InChIKey | MSBOGPIZCWFLTG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |