C17H26ClNO2 — CID 118072893
2-(3-chloro-4,5-diethylphenyl)-3,5,5-trimethylmorpholin-2-ol (PubChem CID 118072893) has the molecular formula C17H26ClNO2 and a molecular weight of 311.85 g/mol. Its IUPAC name is 2-(3-chloro-4,5-diethylphenyl)-3,5,5-trimethylmorpholin-2-ol.
| Compound Name | 2-(3-chloro-4,5-diethylphenyl)-3,5,5-trimethylmorpholin-2-ol |
|---|---|
| PubChem CID | 118072893 |
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2-(3-chloro-4,5-diethylphenyl)-3,5,5-trimethylmorpholin-2-ol |
| SMILES | CCc1cc(C2(O)OCC(C)(C)NC2C)cc(Cl)c1CC |
| InChI | InChI=1S/C17H26ClNO2/c1-6-12-8-13(9-15(18)14(12)7-2)17(20)11(3)19-16(4,5)10-21-17/h8-9,11,19-20H,6-7,10H2,1-5H3 |
| InChIKey | HAYKKBYFNVEFFT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |