C17H27NO2 — CID 118072938
2-(3,5-diethylphenyl)-3,5,5-trimethylmorpholin-2-ol (PubChem CID 118072938) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-(3,5-diethylphenyl)-3,5,5-trimethylmorpholin-2-ol.
| Compound Name | 2-(3,5-diethylphenyl)-3,5,5-trimethylmorpholin-2-ol |
|---|---|
| PubChem CID | 118072938 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-(3,5-diethylphenyl)-3,5,5-trimethylmorpholin-2-ol |
| SMILES | CCc1cc(CC)cc(C2(O)OCC(C)(C)NC2C)c1 |
| InChI | InChI=1S/C17H27NO2/c1-6-13-8-14(7-2)10-15(9-13)17(19)12(3)18-16(4,5)11-20-17/h8-10,12,18-19H,6-7,11H2,1-5H3 |
| InChIKey | XGPNWSUMVSCMOQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |