C21H28FN9O2 — CID 118073634
N-[(3R,4R)-1-[9-tert-butyl-6-[(3-methoxy-1-methylpyrazol-4-yl)amino]purin-2-yl]-4-fluoropyrrolidin-3-yl]prop-2-enamide (PubChem CID 118073634) has the molecular formula C21H28FN9O2 and a molecular weight of 457.51 g/mol. Its IUPAC name is N-[(3R,4R)-1-[9-tert-butyl-6-[(3-methoxy-1-methylpyrazol-4-yl)amino]purin-2-yl]-4-fluoropyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3R,4R)-1-[9-tert-butyl-6-[(3-methoxy-1-methylpyrazol-4-yl)amino]purin-2-yl]-4-fluoropyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 118073634 |
| Molecular Formula | C21H28FN9O2 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | N-[(3R,4R)-1-[9-tert-butyl-6-[(3-methoxy-1-methylpyrazol-4-yl)amino]purin-2-yl]-4-fluoropyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CN(c2nc(Nc3cn(C)nc3OC)c3ncn(C(C)(C)C)c3n2)C[C@H]1F |
| InChI | InChI=1S/C21H28FN9O2/c1-7-15(32)24-13-10-30(8-12(13)22)20-26-17(25-14-9-29(5)28-19(14)33-6)16-18(27-20)31(11-23-16)21(2,3)4/h7,9,11-13H,1,8,10H2,2-6H3,(H,24,32)(H,25,26,27)/t12-,13-/m1/s1 |
| InChIKey | CPHKKAZXAJOGRP-CHWSQXEVSA-N |
| XLogP | 1.90 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|