C19H24FN9O2 — CID 118073728
N-[(3R,4S)-1-[9-ethyl-6-[(3-methoxy-1-methylpyrazol-4-yl)amino]purin-2-yl]-4-fluoropyrrolidin-3-yl]prop-2-enamide (PubChem CID 118073728) has the molecular formula C19H24FN9O2 and a molecular weight of 429.46 g/mol. Its IUPAC name is N-[(3R,4S)-1-[9-ethyl-6-[(3-methoxy-1-methylpyrazol-4-yl)amino]purin-2-yl]-4-fluoropyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3R,4S)-1-[9-ethyl-6-[(3-methoxy-1-methylpyrazol-4-yl)amino]purin-2-yl]-4-fluoropyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 118073728 |
| Molecular Formula | C19H24FN9O2 |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | N-[(3R,4S)-1-[9-ethyl-6-[(3-methoxy-1-methylpyrazol-4-yl)amino]purin-2-yl]-4-fluoropyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CN(c2nc(Nc3cn(C)nc3OC)c3ncn(CC)c3n2)C[C@@H]1F |
| InChI | InChI=1S/C19H24FN9O2/c1-5-14(30)22-12-9-29(7-11(12)20)19-24-16(15-17(25-19)28(6-2)10-21-15)23-13-8-27(3)26-18(13)31-4/h5,8,10-12H,1,6-7,9H2,2-4H3,(H,22,30)(H,23,24,25)/t11-,12+/m0/s1 |
| InChIKey | TVZDMLIBOQCFAB-NWDGAFQWSA-N |
| XLogP | 1.16 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|