C11H12F2O3S — CID 118073737
6,6-bis(1-fluoroethenyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 118073737) has the molecular formula C11H12F2O3S and a molecular weight of 262.28 g/mol. Its IUPAC name is 6,6-bis(1-fluoroethenyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | 6,6-bis(1-fluoroethenyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 118073737 |
| Molecular Formula | C11H12F2O3S |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 6,6-bis(1-fluoroethenyl)-4-methylcyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | C=C(F)C1(C(=C)F)C=C(C)C=CC1S(=O)(=O)O |
| InChI | InChI=1S/C11H12F2O3S/c1-7-4-5-10(17(14,15)16)11(6-7,8(2)12)9(3)13/h4-6,10H,2-3H2,1H3,(H,14,15,16) |
| InChIKey | WZZDVLRFUGOHBJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|