About 7-tert-butylspiro[1-benzofuran-3,5'-oxolane]-2,2'-dione
7-tert-butylspiro[1-benzofuran-3,5'-oxolane]-2,2'-dione (PubChem CID 11807424) has the molecular formula C15H16O4
and a molecular weight of 260.29 g/mol. Its IUPAC name is 7-tert-butylspiro[1-benzofuran-3,5'-oxolane]-2,2'-dione.
Molecular Properties
| Compound Name | 7-tert-butylspiro[1-benzofuran-3,5'-oxolane]-2,2'-dione |
| PubChem CID | 11807424 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 7-tert-butylspiro[1-benzofuran-3,5'-oxolane]-2,2'-dione |
| SMILES | CC(C)(C)c1cccc2c1OC(=O)C21CCC(=O)O1 |
| InChI | InChI=1S/C15H16O4/c1-14(2,3)9-5-4-6-10-12(9)18-13(17)15(10)8-7-11(16)19-15/h4-6H,7-8H2,1-3H3 |
| InChIKey | BPZFSTOKNZUYLZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 7-tert-butylspiro[1-benzofuran-3,5'-oxolane]-2,2'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butylspiro[1-benzofuran-3,5'-oxolane]-2,2'-dione?
The IUPAC name of 7-tert-butylspiro[1-benzofuran-3,5'-oxolane]-2,2'-dione (CID 11807424) is 7-tert-butylspiro[1-benzofuran-3,5'-oxolane]-2,2'-dione.
What is the SMILES notation for 7-tert-butylspiro[1-benzofuran-3,5'-oxolane]-2,2'-dione?
The canonical SMILES for 7-tert-butylspiro[1-benzofuran-3,5'-oxolane]-2,2'-dione is CC(C)(C)c1cccc2c1OC(=O)C21CCC(=O)O1.
What is the InChIKey of 7-tert-butylspiro[1-benzofuran-3,5'-oxolane]-2,2'-dione?
The InChIKey is BPZFSTOKNZUYLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O4/c1-14(2,3)9-5-4-6-10-12(9)18-13(17)15(10)8-7-11(16)19-15/h4-6H,7-8H2,1-3H3.
What are the key properties of 7-tert-butylspiro[1-benzofuran-3,5'-oxolane]-2,2'-dione?
7-tert-butylspiro[1-benzofuran-3,5'-oxolane]-2,2'-dione has a molecular weight of 260.29 g/mol, XLogP of 2.44, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butylspiro[1-benzofuran-3,5'-oxolane]-2,2'-dione is sourced from PubChem (CID 11807424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).